C13H15F4N3S — CID 79515591
2-fluoro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide (PubChem CID 79515591) has the molecular formula C13H15F4N3S and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-fluoro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide.
| Compound Name | 2-fluoro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide |
|---|---|
| PubChem CID | 79515591 |
| Molecular Formula | C13H15F4N3S |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-fluoro-6-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]benzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H15F4N3S/c14-9-2-1-3-10(11(9)12(18)21)20-6-4-19(5-7-20)8-13(15,16)17/h1-3H,4-8H2,(H2,18,21) |
| InChIKey | KBLLFHXAVHZHSN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|