C13H6F4N2O2 — CID 79516333
1-(2-cyano-3-fluorophenyl)-4-(trifluoromethyl)pyrrole-3-carboxylic acid (PubChem CID 79516333) has the molecular formula C13H6F4N2O2 and a molecular weight of 298.20 g/mol. Its IUPAC name is 1-(2-cyano-3-fluorophenyl)-4-(trifluoromethyl)pyrrole-3-carboxylic acid.
| Compound Name | 1-(2-cyano-3-fluorophenyl)-4-(trifluoromethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 79516333 |
| Molecular Formula | C13H6F4N2O2 |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 1-(2-cyano-3-fluorophenyl)-4-(trifluoromethyl)pyrrole-3-carboxylic acid |
| SMILES | N#Cc1c(F)cccc1-n1cc(C(=O)O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H6F4N2O2/c14-10-2-1-3-11(7(10)4-18)19-5-8(12(20)21)9(6-19)13(15,16)17/h1-3,5-6H,(H,20,21) |
| InChIKey | XCONLKHXDJVWSL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |