C15H14FN3S — CID 79516723
[2-fluoro-6-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]phenyl]methanamine (PubChem CID 79516723) has the molecular formula C15H14FN3S and a molecular weight of 287.36 g/mol. Its IUPAC name is [2-fluoro-6-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]phenyl]methanamine.
| Compound Name | [2-fluoro-6-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]phenyl]methanamine |
|---|---|
| PubChem CID | 79516723 |
| Molecular Formula | C15H14FN3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | [2-fluoro-6-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]phenyl]methanamine |
| SMILES | Cc1ccc2nc(Sc3cccc(F)c3CN)[nH]c2c1 |
| InChI | InChI=1S/C15H14FN3S/c1-9-5-6-12-13(7-9)19-15(18-12)20-14-4-2-3-11(16)10(14)8-17/h2-7H,8,17H2,1H3,(H,18,19) |
| InChIKey | KQRCFNXMHDINKV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |