C18H19N3OS — CID 7951748
6-ethyl-3-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]thieno[2,3-d]pyrimidin-4-one (PubChem CID 7951748) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 6-ethyl-3-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 6-ethyl-3-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7951748 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 6-ethyl-3-[(Z)-(2,4,6-trimethylphenyl)methylideneamino]thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1cc2c(=O)n(/N=C\c3c(C)cc(C)cc3C)cnc2s1 |
| InChI | InChI=1S/C18H19N3OS/c1-5-14-8-15-17(23-14)19-10-21(18(15)22)20-9-16-12(3)6-11(2)7-13(16)4/h6-10H,5H2,1-4H3/b20-9- |
| InChIKey | HKFZNNVHTBQOFG-UKWGHVSLSA-N |
| XLogP | 3.83 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|