C11H15N3O3 — CID 79517733
1-[1-(2-methoxyethyl)pyrazol-4-yl]piperidine-2,4-dione (PubChem CID 79517733) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)pyrazol-4-yl]piperidine-2,4-dione.
| Compound Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]piperidine-2,4-dione |
|---|---|
| PubChem CID | 79517733 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 1-[1-(2-methoxyethyl)pyrazol-4-yl]piperidine-2,4-dione |
| SMILES | COCCn1cc(N2CCC(=O)CC2=O)cn1 |
| InChI | InChI=1S/C11H15N3O3/c1-17-5-4-13-8-9(7-12-13)14-3-2-10(15)6-11(14)16/h7-8H,2-6H2,1H3 |
| InChIKey | OWUOOAAVCWMOJU-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|