C16H16FNOS — CID 79519677
2-fluoro-6-(2,3,5-trimethylphenoxy)benzenecarbothioamide (PubChem CID 79519677) has the molecular formula C16H16FNOS and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-fluoro-6-(2,3,5-trimethylphenoxy)benzenecarbothioamide.
| Compound Name | 2-fluoro-6-(2,3,5-trimethylphenoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 79519677 |
| Molecular Formula | C16H16FNOS |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-fluoro-6-(2,3,5-trimethylphenoxy)benzenecarbothioamide |
| SMILES | Cc1cc(C)c(C)c(Oc2cccc(F)c2C(N)=S)c1 |
| InChI | InChI=1S/C16H16FNOS/c1-9-7-10(2)11(3)14(8-9)19-13-6-4-5-12(17)15(13)16(18)20/h4-8H,1-3H3,(H2,18,20) |
| InChIKey | ATCHRNSSXHMZRD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|