C19H24N2O3 — CID 7952037
(3aR,7aR)-2-[2-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-oxoethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 7952037) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3aR,7aR)-2-[2-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-oxoethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[2-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-oxoethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7952037 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (3aR,7aR)-2-[2-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-oxoethyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Cc1cc(C(=O)CN2C(=O)[C@@H]3CC=CC[C@H]3C2=O)c(C)n1C(C)C |
| InChI | InChI=1S/C19H24N2O3/c1-11(2)21-12(3)9-16(13(21)4)17(22)10-20-18(23)14-7-5-6-8-15(14)19(20)24/h5-6,9,11,14-15H,7-8,10H2,1-4H3/t14-,15-/m1/s1 |
| InChIKey | SQWIEISZPPESKI-HUUCEWRRSA-N |
| XLogP | 2.82 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|