C17H25N3 — CID 79521295
1-cyclopentyl-5-(2-phenylpropyl)-4,5-dihydroimidazol-2-amine (PubChem CID 79521295) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-cyclopentyl-5-(2-phenylpropyl)-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-cyclopentyl-5-(2-phenylpropyl)-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79521295 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1-cyclopentyl-5-(2-phenylpropyl)-4,5-dihydroimidazol-2-amine |
| SMILES | CC(CC1CN=C(N)N1C1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H25N3/c1-13(14-7-3-2-4-8-14)11-16-12-19-17(18)20(16)15-9-5-6-10-15/h2-4,7-8,13,15-16H,5-6,9-12H2,1H3,(H2,18,19) |
| InChIKey | KRCAEVWRDXIGGP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |