About 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine
1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine (PubChem CID 79521583) has the molecular formula C14H24N4
and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine.
Molecular Properties
| Compound Name | 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine |
| PubChem CID | 79521583 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine |
| SMILES | CN1C2CCC1CC1(CN=C(N)N1CC1CC1)C2 |
| InChI | InChI=1S/C14H24N4/c1-17-11-4-5-12(17)7-14(6-11)9-16-13(15)18(14)8-10-2-3-10/h10-12H,2-9H2,1H3,(H2,15,16) |
| InChIKey | WWHMIPOWEMSJEF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
The IUPAC name of 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine (CID 79521583) is 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine.
What is the SMILES notation for 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
The canonical SMILES for 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine is CN1C2CCC1CC1(CN=C(N)N1CC1CC1)C2.
What is the InChIKey of 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
The InChIKey is WWHMIPOWEMSJEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N4/c1-17-11-4-5-12(17)7-14(6-11)9-16-13(15)18(14)8-10-2-3-10/h10-12H,2-9H2,1H3,(H2,15,16).
What are the key properties of 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine?
1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine has a molecular weight of 248.37 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylmethyl)-8'-methylspiro[4H-imidazole-5,3'-8-azabicyclo[3.2.1]octane]-2-amine is sourced from PubChem (CID 79521583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).