C12H13F2N — CID 79522247
1-(2,6-difluorophenyl)-N-propylprop-2-yn-1-amine (PubChem CID 79522247) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N-propylprop-2-yn-1-amine.
| Compound Name | 1-(2,6-difluorophenyl)-N-propylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 79522247 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N-propylprop-2-yn-1-amine |
| SMILES | C#CC(NCCC)c1c(F)cccc1F |
| InChI | InChI=1S/C12H13F2N/c1-3-8-15-11(4-2)12-9(13)6-5-7-10(12)14/h2,5-7,11,15H,3,8H2,1H3 |
| InChIKey | PWTFHHRKQMYTIG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|