C14H8F4O — CID 79522311
2-(2,3-difluorophenyl)-1-(2,6-difluorophenyl)ethanone (PubChem CID 79522311) has the molecular formula C14H8F4O and a molecular weight of 268.21 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-1-(2,6-difluorophenyl)ethanone.
| Compound Name | 2-(2,3-difluorophenyl)-1-(2,6-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 79522311 |
| Molecular Formula | C14H8F4O |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(2,3-difluorophenyl)-1-(2,6-difluorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(F)c1F)c1c(F)cccc1F |
| InChI | InChI=1S/C14H8F4O/c15-9-4-2-5-10(16)13(9)12(19)7-8-3-1-6-11(17)14(8)18/h1-6H,7H2 |
| InChIKey | FJFPEFZVINNXRB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |