C15H21F2N — CID 79522643
N-[2-cyclobutyl-1-(2,6-difluorophenyl)ethyl]propan-1-amine (PubChem CID 79522643) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is N-[2-cyclobutyl-1-(2,6-difluorophenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-cyclobutyl-1-(2,6-difluorophenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79522643 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | N-[2-cyclobutyl-1-(2,6-difluorophenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(CC1CCC1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H21F2N/c1-2-9-18-14(10-11-5-3-6-11)15-12(16)7-4-8-13(15)17/h4,7-8,11,14,18H,2-3,5-6,9-10H2,1H3 |
| InChIKey | VFINXAHVRRMWCZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |