C12H13F2N3 — CID 79522981
(2,6-difluorophenyl)-(2-ethylpyrazol-3-yl)methanamine (PubChem CID 79522981) has the molecular formula C12H13F2N3 and a molecular weight of 237.25 g/mol. Its IUPAC name is (2,6-difluorophenyl)-(2-ethylpyrazol-3-yl)methanamine.
| Compound Name | (2,6-difluorophenyl)-(2-ethylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 79522981 |
| Molecular Formula | C12H13F2N3 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | (2,6-difluorophenyl)-(2-ethylpyrazol-3-yl)methanamine |
| SMILES | CCn1nccc1C(N)c1c(F)cccc1F |
| InChI | InChI=1S/C12H13F2N3/c1-2-17-10(6-7-16-17)12(15)11-8(13)4-3-5-9(11)14/h3-7,12H,2,15H2,1H3 |
| InChIKey | CCMRJFOLMYFXAQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |