About 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide
7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide (PubChem CID 79523748) has the molecular formula C10H19N3O3
and a molecular weight of 229.28 g/mol. Its IUPAC name is 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide.
Molecular Properties
| Compound Name | 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide |
| PubChem CID | 79523748 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide |
| SMILES | NCCCCCCC(=O)N[C@@H]1CONC1=O |
| InChI | InChI=1S/C10H19N3O3/c11-6-4-2-1-3-5-9(14)12-8-7-16-13-10(8)15/h8H,1-7,11H2,(H,12,14)(H,13,15)/t8-/m1/s1 |
| InChIKey | CEVXHTBYXPGKKB-MRVPVSSYSA-N |
| XLogP | -0.56 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide?
The IUPAC name of 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide (CID 79523748) is 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide.
What is the SMILES notation for 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide?
The canonical SMILES for 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide is NCCCCCCC(=O)N[C@@H]1CONC1=O.
What is the InChIKey of 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide?
The InChIKey is CEVXHTBYXPGKKB-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H19N3O3/c11-6-4-2-1-3-5-9(14)12-8-7-16-13-10(8)15/h8H,1-7,11H2,(H,12,14)(H,13,15)/t8-/m1/s1.
What are the key properties of 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide?
7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide has a molecular weight of 229.28 g/mol, XLogP of -0.56, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]heptanamide is sourced from PubChem (CID 79523748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).