C17H16Cl2N2O3 — CID 7952417
2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2,6-dichloro-3-methylphenyl)acetamide (PubChem CID 7952417) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2,6-dichloro-3-methylphenyl)acetamide.
| Compound Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2,6-dichloro-3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 7952417 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 2-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(2,6-dichloro-3-methylphenyl)acetamide |
| SMILES | Cc1ccc(Cl)c(NC(=O)CN2C(=O)[C@H]3CC=CC[C@@H]3C2=O)c1Cl |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-9-6-7-12(18)15(14(9)19)20-13(22)8-21-16(23)10-4-2-3-5-11(10)17(21)24/h2-3,6-7,10-11H,4-5,8H2,1H3,(H,20,22)/t10-,11-/m0/s1 |
| InChIKey | HKKZHHDGJXHGPL-QWRGUYRKSA-N |
| XLogP | 3.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|