About 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide
2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide (PubChem CID 79524259) has the molecular formula C9H17N3O3
and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide.
Molecular Properties
| Compound Name | 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide |
| PubChem CID | 79524259 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide |
| SMILES | CCCCC(N)C(=O)N[C@@H]1CONC1=O |
| InChI | InChI=1S/C9H17N3O3/c1-2-3-4-6(10)8(13)11-7-5-15-12-9(7)14/h6-7H,2-5,10H2,1H3,(H,11,13)(H,12,14)/t6?,7-/m1/s1 |
| InChIKey | PSEZPMOMXPIFOH-COBSHVIPSA-N |
| XLogP | -0.95 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide?
The IUPAC name of 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide (CID 79524259) is 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide.
What is the SMILES notation for 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide?
The canonical SMILES for 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide is CCCCC(N)C(=O)N[C@@H]1CONC1=O.
What is the InChIKey of 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide?
The InChIKey is PSEZPMOMXPIFOH-COBSHVIPSA-N. The full InChI is InChI=1S/C9H17N3O3/c1-2-3-4-6(10)8(13)11-7-5-15-12-9(7)14/h6-7H,2-5,10H2,1H3,(H,11,13)(H,12,14)/t6?,7-/m1/s1.
What are the key properties of 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide?
2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide has a molecular weight of 215.25 g/mol, XLogP of -0.95, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]hexanamide is sourced from PubChem (CID 79524259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).