About 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide
3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide (PubChem CID 79524440) has the molecular formula C7H13N3O3
and a molecular weight of 187.20 g/mol. Its IUPAC name is 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide.
Molecular Properties
| Compound Name | 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide |
| PubChem CID | 79524440 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide |
| SMILES | CC(N)CC(=O)N[C@@H]1CONC1=O |
| InChI | InChI=1S/C7H13N3O3/c1-4(8)2-6(11)9-5-3-13-10-7(5)12/h4-5H,2-3,8H2,1H3,(H,9,11)(H,10,12)/t4?,5-/m1/s1 |
| InChIKey | PMEHHZWRRHXXPG-BRJRFNKRSA-N |
| XLogP | -1.73 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide?
The IUPAC name of 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide (CID 79524440) is 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide.
What is the SMILES notation for 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide?
The canonical SMILES for 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide is CC(N)CC(=O)N[C@@H]1CONC1=O.
What is the InChIKey of 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide?
The InChIKey is PMEHHZWRRHXXPG-BRJRFNKRSA-N. The full InChI is InChI=1S/C7H13N3O3/c1-4(8)2-6(11)9-5-3-13-10-7(5)12/h4-5H,2-3,8H2,1H3,(H,9,11)(H,10,12)/t4?,5-/m1/s1.
What are the key properties of 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide?
3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide has a molecular weight of 187.20 g/mol, XLogP of -1.73, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[(4R)-3-oxo-1,2-oxazolidin-4-yl]butanamide is sourced from PubChem (CID 79524440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).