C16H21NO3S — CID 79526390
4-[[3-(3-methylthiophen-2-yl)prop-2-enoylamino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 79526390) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-[[3-(3-methylthiophen-2-yl)prop-2-enoylamino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-(3-methylthiophen-2-yl)prop-2-enoylamino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79526390 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-[[3-(3-methylthiophen-2-yl)prop-2-enoylamino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccsc1C=CC(=O)NCC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H21NO3S/c1-11-8-9-21-14(11)6-7-15(18)17-10-12-2-4-13(5-3-12)16(19)20/h6-9,12-13H,2-5,10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | QSYKWNRZSBIERN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|