C14H17ClN2S — CID 79528629
(6-chloro-1,3-benzothiazol-2-yl)-cyclohexylmethanamine (PubChem CID 79528629) has the molecular formula C14H17ClN2S and a molecular weight of 280.82 g/mol. Its IUPAC name is (6-chloro-1,3-benzothiazol-2-yl)-cyclohexylmethanamine.
| Compound Name | (6-chloro-1,3-benzothiazol-2-yl)-cyclohexylmethanamine |
|---|---|
| PubChem CID | 79528629 |
| Molecular Formula | C14H17ClN2S |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (6-chloro-1,3-benzothiazol-2-yl)-cyclohexylmethanamine |
| SMILES | NC(c1nc2ccc(Cl)cc2s1)C1CCCCC1 |
| InChI | InChI=1S/C14H17ClN2S/c15-10-6-7-11-12(8-10)18-14(17-11)13(16)9-4-2-1-3-5-9/h6-9,13H,1-5,16H2 |
| InChIKey | WCNAIIYIDJGMCG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |