C18H33NO2 — CID 79530082
4-[[(4-propylcycloheptyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 79530082) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is 4-[[(4-propylcycloheptyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(4-propylcycloheptyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79530082 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | 4-[[(4-propylcycloheptyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | CCCC1CCCC(NCC2CCC(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C18H33NO2/c1-2-4-14-5-3-6-17(12-9-14)19-13-15-7-10-16(11-8-15)18(20)21/h14-17,19H,2-13H2,1H3,(H,20,21) |
| InChIKey | YSZCKYOFCKTXFJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |