About 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine
1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine (PubChem CID 79530372) has the molecular formula C7H10N6O
and a molecular weight of 194.20 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine.
Molecular Properties
| Compound Name | 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine |
| PubChem CID | 79530372 |
| Molecular Formula | C7H10N6O |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine |
| SMILES | CCc1nnc(Cn2cc(N)nn2)o1 |
| InChI | InChI=1S/C7H10N6O/c1-2-6-10-11-7(14-6)4-13-3-5(8)9-12-13/h3H,2,4,8H2,1H3 |
| InChIKey | PBUXZOGUYRTHNF-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine?
The IUPAC name of 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine (CID 79530372) is 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine.
What is the SMILES notation for 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine?
The canonical SMILES for 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine is CCc1nnc(Cn2cc(N)nn2)o1.
What is the InChIKey of 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine?
The InChIKey is PBUXZOGUYRTHNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6O/c1-2-6-10-11-7(14-6)4-13-3-5(8)9-12-13/h3H,2,4,8H2,1H3.
What are the key properties of 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine?
1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine has a molecular weight of 194.20 g/mol, XLogP of -0.15, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine is sourced from PubChem (CID 79530372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).