About 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline
2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline (PubChem CID 79530432) has the molecular formula C13H14F3N3O2
and a molecular weight of 301.27 g/mol. Its IUPAC name is 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline |
| PubChem CID | 79530432 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline |
| SMILES | CCOC(C)c1noc(-c2ccc(C(F)(F)F)cc2N)n1 |
| InChI | InChI=1S/C13H14F3N3O2/c1-3-20-7(2)11-18-12(21-19-11)9-5-4-8(6-10(9)17)13(14,15)16/h4-7H,3,17H2,1-2H3 |
| InChIKey | PEJWHCDXQMPEEQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline?
The IUPAC name of 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline (CID 79530432) is 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline.
What is the SMILES notation for 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline?
The canonical SMILES for 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline is CCOC(C)c1noc(-c2ccc(C(F)(F)F)cc2N)n1.
What is the InChIKey of 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline?
The InChIKey is PEJWHCDXQMPEEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N3O2/c1-3-20-7(2)11-18-12(21-19-11)9-5-4-8(6-10(9)17)13(14,15)16/h4-7H,3,17H2,1-2H3.
What are the key properties of 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline?
2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline has a molecular weight of 301.27 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline is sourced from PubChem (CID 79530432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).