C15H18BrN3O2 — CID 79530686
3-bromo-2-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-2,5-diamine (PubChem CID 79530686) has the molecular formula C15H18BrN3O2 and a molecular weight of 352.23 g/mol. Its IUPAC name is 3-bromo-2-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-2,5-diamine.
| Compound Name | 3-bromo-2-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 79530686 |
| Molecular Formula | C15H18BrN3O2 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 3-bromo-2-N-[2-(3,4-dimethoxyphenyl)ethyl]pyridine-2,5-diamine |
| SMILES | COc1ccc(CCNc2ncc(N)cc2Br)cc1OC |
| InChI | InChI=1S/C15H18BrN3O2/c1-20-13-4-3-10(7-14(13)21-2)5-6-18-15-12(16)8-11(17)9-19-15/h3-4,7-9H,5-6,17H2,1-2H3,(H,18,19) |
| InChIKey | OXJRQAFUILYFMU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |