About 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine
1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine (PubChem CID 79530807) has the molecular formula C7H9N5S
and a molecular weight of 195.25 g/mol. Its IUPAC name is 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine.
Molecular Properties
| Compound Name | 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine |
| PubChem CID | 79530807 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine |
| SMILES | Cc1ncc(Cn2cc(N)nn2)s1 |
| InChI | InChI=1S/C7H9N5S/c1-5-9-2-6(13-5)3-12-4-7(8)10-11-12/h2,4H,3,8H2,1H3 |
| InChIKey | AYWZNBWKJHKQAT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine?
The IUPAC name of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine (CID 79530807) is 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine.
What is the SMILES notation for 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine?
The canonical SMILES for 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine is Cc1ncc(Cn2cc(N)nn2)s1.
What is the InChIKey of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine?
The InChIKey is AYWZNBWKJHKQAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5S/c1-5-9-2-6(13-5)3-12-4-7(8)10-11-12/h2,4H,3,8H2,1H3.
What are the key properties of 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine?
1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine has a molecular weight of 195.25 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methyl-1,3-thiazol-5-yl)methyl]triazol-4-amine is sourced from PubChem (CID 79530807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).