C12H14N2O6S — CID 79531271
2,4-dimethyl-5-[[(4R)-3-oxo-1,2-oxazolidin-4-yl]sulfamoyl]benzoic acid (PubChem CID 79531271) has the molecular formula C12H14N2O6S and a molecular weight of 314.32 g/mol. Its IUPAC name is 2,4-dimethyl-5-[[(4R)-3-oxo-1,2-oxazolidin-4-yl]sulfamoyl]benzoic acid.
| Compound Name | 2,4-dimethyl-5-[[(4R)-3-oxo-1,2-oxazolidin-4-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 79531271 |
| Molecular Formula | C12H14N2O6S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2,4-dimethyl-5-[[(4R)-3-oxo-1,2-oxazolidin-4-yl]sulfamoyl]benzoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@@H]2CONC2=O)cc1C(=O)O |
| InChI | InChI=1S/C12H14N2O6S/c1-6-3-7(2)10(4-8(6)12(16)17)21(18,19)14-9-5-20-13-11(9)15/h3-4,9,14H,5H2,1-2H3,(H,13,15)(H,16,17)/t9-/m1/s1 |
| InChIKey | ULUMAUQQGQBOJK-SECBINFHSA-N |
| XLogP | -0.29 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |