About 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine
3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine (PubChem CID 79531944) has the molecular formula C13H14BrN3O2
and a molecular weight of 324.18 g/mol. Its IUPAC name is 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine |
| PubChem CID | 79531944 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine |
| SMILES | COc1cc(Nc2ncc(N)cc2Br)cc(OC)c1 |
| InChI | InChI=1S/C13H14BrN3O2/c1-18-10-4-9(5-11(6-10)19-2)17-13-12(14)3-8(15)7-16-13/h3-7H,15H2,1-2H3,(H,16,17) |
| InChIKey | YZHZRKDCHXPHHT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine?
The IUPAC name of 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine (CID 79531944) is 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine.
What is the SMILES notation for 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine?
The canonical SMILES for 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine is COc1cc(Nc2ncc(N)cc2Br)cc(OC)c1.
What is the InChIKey of 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine?
The InChIKey is YZHZRKDCHXPHHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrN3O2/c1-18-10-4-9(5-11(6-10)19-2)17-13-12(14)3-8(15)7-16-13/h3-7H,15H2,1-2H3,(H,16,17).
What are the key properties of 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine?
3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine has a molecular weight of 324.18 g/mol, XLogP of 3.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-N-(3,5-dimethoxyphenyl)pyridine-2,5-diamine is sourced from PubChem (CID 79531944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).