C9H12BrN3O4S — CID 79534255
3-bromo-N-(1-methylsulfonylpropan-2-yl)-5-nitropyridin-2-amine (PubChem CID 79534255) has the molecular formula C9H12BrN3O4S and a molecular weight of 338.18 g/mol. Its IUPAC name is 3-bromo-N-(1-methylsulfonylpropan-2-yl)-5-nitropyridin-2-amine.
| Compound Name | 3-bromo-N-(1-methylsulfonylpropan-2-yl)-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 79534255 |
| Molecular Formula | C9H12BrN3O4S |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 3-bromo-N-(1-methylsulfonylpropan-2-yl)-5-nitropyridin-2-amine |
| SMILES | CC(CS(C)(=O)=O)Nc1ncc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C9H12BrN3O4S/c1-6(5-18(2,16)17)12-9-8(10)3-7(4-11-9)13(14)15/h3-4,6H,5H2,1-2H3,(H,11,12) |
| InChIKey | UQLIFAWHIBPNJU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|