C13H13BrFN3 — CID 79534994
3-bromo-2-N-ethyl-2-N-(3-fluorophenyl)pyridine-2,5-diamine (PubChem CID 79534994) has the molecular formula C13H13BrFN3 and a molecular weight of 310.17 g/mol. Its IUPAC name is 3-bromo-2-N-ethyl-2-N-(3-fluorophenyl)pyridine-2,5-diamine.
| Compound Name | 3-bromo-2-N-ethyl-2-N-(3-fluorophenyl)pyridine-2,5-diamine |
|---|---|
| PubChem CID | 79534994 |
| Molecular Formula | C13H13BrFN3 |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 3-bromo-2-N-ethyl-2-N-(3-fluorophenyl)pyridine-2,5-diamine |
| SMILES | CCN(c1cccc(F)c1)c1ncc(N)cc1Br |
| InChI | InChI=1S/C13H13BrFN3/c1-2-18(11-5-3-4-9(15)6-11)13-12(14)7-10(16)8-17-13/h3-8H,2,16H2,1H3 |
| InChIKey | BLMMEVXLPUJMIR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |