About 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine
5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine (PubChem CID 79537698) has the molecular formula C16H22N4O
and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine.
Molecular Properties
| Compound Name | 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine |
| PubChem CID | 79537698 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine |
| SMILES | Cc1ccc(C)c(OCCCn2nnc(N)c2C2CC2)c1 |
| InChI | InChI=1S/C16H22N4O/c1-11-4-5-12(2)14(10-11)21-9-3-8-20-15(13-6-7-13)16(17)18-19-20/h4-5,10,13H,3,6-9,17H2,1-2H3 |
| InChIKey | KXAGUWOJZAGBAX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine?
The IUPAC name of 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine (CID 79537698) is 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine.
What is the SMILES notation for 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine?
The canonical SMILES for 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine is Cc1ccc(C)c(OCCCn2nnc(N)c2C2CC2)c1.
What is the InChIKey of 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine?
The InChIKey is KXAGUWOJZAGBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4O/c1-11-4-5-12(2)14(10-11)21-9-3-8-20-15(13-6-7-13)16(17)18-19-20/h4-5,10,13H,3,6-9,17H2,1-2H3.
What are the key properties of 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine?
5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine has a molecular weight of 286.38 g/mol, XLogP of 2.82, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-1-[3-(2,5-dimethylphenoxy)propyl]triazol-4-amine is sourced from PubChem (CID 79537698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).