C19H19N5O2S — CID 7953800
[4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl (E)-3-thiophen-2-ylprop-2-enoate (PubChem CID 7953800) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is [4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl (E)-3-thiophen-2-ylprop-2-enoate.
| Compound Name | [4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl (E)-3-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 7953800 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [4-amino-6-(2-ethylanilino)-1,3,5-triazin-2-yl]methyl (E)-3-thiophen-2-ylprop-2-enoate |
| SMILES | CCc1ccccc1Nc1nc(N)nc(COC(=O)/C=C/c2cccs2)n1 |
| InChI | InChI=1S/C19H19N5O2S/c1-2-13-6-3-4-8-15(13)21-19-23-16(22-18(20)24-19)12-26-17(25)10-9-14-7-5-11-27-14/h3-11H,2,12H2,1H3,(H3,20,21,22,23,24)/b10-9+ |
| InChIKey | YTKYBIBGEADGMU-MDZDMXLPSA-N |
| XLogP | 3.58 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|