C16H23N5 — CID 79538123
N-(1-piperidin-2-ylpropan-2-yl)-4-(1,2,4-triazol-1-yl)aniline (PubChem CID 79538123) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is N-(1-piperidin-2-ylpropan-2-yl)-4-(1,2,4-triazol-1-yl)aniline.
| Compound Name | N-(1-piperidin-2-ylpropan-2-yl)-4-(1,2,4-triazol-1-yl)aniline |
|---|---|
| PubChem CID | 79538123 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N-(1-piperidin-2-ylpropan-2-yl)-4-(1,2,4-triazol-1-yl)aniline |
| SMILES | CC(CC1CCCCN1)Nc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C16H23N5/c1-13(10-15-4-2-3-9-18-15)20-14-5-7-16(8-6-14)21-12-17-11-19-21/h5-8,11-13,15,18,20H,2-4,9-10H2,1H3 |
| InChIKey | UPBOCUTUSJYPFO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |