C15H22F3NO2 — CID 79538269
N-(2,2-diethoxyethyl)-3,3,3-trifluoro-1-phenylpropan-1-amine (PubChem CID 79538269) has the molecular formula C15H22F3NO2 and a molecular weight of 305.34 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-3,3,3-trifluoro-1-phenylpropan-1-amine.
| Compound Name | N-(2,2-diethoxyethyl)-3,3,3-trifluoro-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 79538269 |
| Molecular Formula | C15H22F3NO2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | N-(2,2-diethoxyethyl)-3,3,3-trifluoro-1-phenylpropan-1-amine |
| SMILES | CCOC(CNC(CC(F)(F)F)c1ccccc1)OCC |
| InChI | InChI=1S/C15H22F3NO2/c1-3-20-14(21-4-2)11-19-13(10-15(16,17)18)12-8-6-5-7-9-12/h5-9,13-14,19H,3-4,10-11H2,1-2H3 |
| InChIKey | SJFJSTFBHXLTKW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|