C15H18F3NO — CID 79539404
2-(azepan-2-yl)-1-[2-(trifluoromethyl)phenyl]ethanone (PubChem CID 79539404) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-(azepan-2-yl)-1-[2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-(azepan-2-yl)-1-[2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 79539404 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-(azepan-2-yl)-1-[2-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(CC1CCCCCN1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO/c16-15(17,18)13-8-4-3-7-12(13)14(20)10-11-6-2-1-5-9-19-11/h3-4,7-8,11,19H,1-2,5-6,9-10H2 |
| InChIKey | LANQKSIMDCHJAJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |