C17H26N2O2 — CID 79540466
1-(azepan-2-yl)-N-(1,3-benzodioxol-4-ylmethyl)propan-2-amine (PubChem CID 79540466) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-(azepan-2-yl)-N-(1,3-benzodioxol-4-ylmethyl)propan-2-amine.
| Compound Name | 1-(azepan-2-yl)-N-(1,3-benzodioxol-4-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 79540466 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-(azepan-2-yl)-N-(1,3-benzodioxol-4-ylmethyl)propan-2-amine |
| SMILES | CC(CC1CCCCCN1)NCc1cccc2c1OCO2 |
| InChI | InChI=1S/C17H26N2O2/c1-13(10-15-7-3-2-4-9-18-15)19-11-14-6-5-8-16-17(14)21-12-20-16/h5-6,8,13,15,18-19H,2-4,7,9-12H2,1H3 |
| InChIKey | BLQDTOVYPAJXCI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |