About N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine
N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine (PubChem CID 79540795) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine.
Analyze N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine?
The IUPAC name of N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine (CID 79540795) is N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine is CC(CC1CCCN1)NCCN.
What is the InChIKey of N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine?
The InChIKey is YOLQEIVLNHZHCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3/c1-8(11-6-4-10)7-9-3-2-5-12-9/h8-9,11-12H,2-7,10H2,1H3.
What are the key properties of N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine?
N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine has a molecular weight of 171.29 g/mol, XLogP of 0.07, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(1-pyrrolidin-2-ylpropan-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 79540795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).