C16H26N2O2S — CID 79540847
3-[1-(azepan-2-yl)propan-2-ylamino]-3-thiophen-2-ylpropanoic acid (PubChem CID 79540847) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 3-[1-(azepan-2-yl)propan-2-ylamino]-3-thiophen-2-ylpropanoic acid.
| Compound Name | 3-[1-(azepan-2-yl)propan-2-ylamino]-3-thiophen-2-ylpropanoic acid |
|---|---|
| PubChem CID | 79540847 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 3-[1-(azepan-2-yl)propan-2-ylamino]-3-thiophen-2-ylpropanoic acid |
| SMILES | CC(CC1CCCCCN1)NC(CC(=O)O)c1cccs1 |
| InChI | InChI=1S/C16H26N2O2S/c1-12(10-13-6-3-2-4-8-17-13)18-14(11-16(19)20)15-7-5-9-21-15/h5,7,9,12-14,17-18H,2-4,6,8,10-11H2,1H3,(H,19,20) |
| InChIKey | JGPGQPCTMGOCEX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |