About 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine
1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine (PubChem CID 79542077) has the molecular formula C13H22N6
and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine.
Molecular Properties
| Compound Name | 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine |
| PubChem CID | 79542077 |
| Molecular Formula | C13H22N6 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine |
| SMILES | CCCc1c(N)nnn1Cc1cc(CC)nn1CC |
| InChI | InChI=1S/C13H22N6/c1-4-7-12-13(14)15-17-19(12)9-11-8-10(5-2)16-18(11)6-3/h8H,4-7,9,14H2,1-3H3 |
| InChIKey | NVERHTSONLSVPK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine?
The IUPAC name of 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine (CID 79542077) is 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine.
What is the SMILES notation for 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine?
The canonical SMILES for 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine is CCCc1c(N)nnn1Cc1cc(CC)nn1CC.
What is the InChIKey of 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine?
The InChIKey is NVERHTSONLSVPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N6/c1-4-7-12-13(14)15-17-19(12)9-11-8-10(5-2)16-18(11)6-3/h8H,4-7,9,14H2,1-3H3.
What are the key properties of 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine?
1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine has a molecular weight of 262.36 g/mol, XLogP of 1.64, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,3-diethylpyrazol-5-yl)methyl]-5-propyltriazol-4-amine is sourced from PubChem (CID 79542077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).