About 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine
5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine (PubChem CID 79542536) has the molecular formula C10H17N7
and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine.
Molecular Properties
| Compound Name | 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine |
| PubChem CID | 79542536 |
| Molecular Formula | C10H17N7 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine |
| SMILES | CCCn1ncnc1Cn1nnc(N)c1CC |
| InChI | InChI=1S/C10H17N7/c1-3-5-16-9(12-7-13-16)6-17-8(4-2)10(11)14-15-17/h7H,3-6,11H2,1-2H3 |
| InChIKey | YKVVASKEFOUCTB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine?
The IUPAC name of 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine (CID 79542536) is 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine.
What is the SMILES notation for 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine?
The canonical SMILES for 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine is CCCn1ncnc1Cn1nnc(N)c1CC.
What is the InChIKey of 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine?
The InChIKey is YKVVASKEFOUCTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N7/c1-3-5-16-9(12-7-13-16)6-17-8(4-2)10(11)14-15-17/h7H,3-6,11H2,1-2H3.
What are the key properties of 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine?
5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine has a molecular weight of 235.29 g/mol, XLogP of 0.47, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-[(2-propyl-1,2,4-triazol-3-yl)methyl]triazol-4-amine is sourced from PubChem (CID 79542536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).