About 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one
1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one (PubChem CID 795426) has the molecular formula C11H12N4O
and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one.
Molecular Properties
| Compound Name | 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one |
| PubChem CID | 795426 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one |
| SMILES | Nc1nncn1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C11H12N4O/c12-11-14-13-8-15(11)10(16)7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,12,14) |
| InChIKey | MTYQVQHJEWYQKW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one?
The IUPAC name of 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one (CID 795426) is 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one.
What is the SMILES notation for 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one?
The canonical SMILES for 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one is Nc1nncn1C(=O)CCc1ccccc1.
What is the InChIKey of 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one?
The InChIKey is MTYQVQHJEWYQKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O/c12-11-14-13-8-15(11)10(16)7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,12,14).
What are the key properties of 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one?
1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one has a molecular weight of 216.24 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-1,2,4-triazol-4-yl)-3-phenylpropan-1-one is sourced from PubChem (CID 795426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).