About 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine
5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine (PubChem CID 79542816) has the molecular formula C8H12N6O
and a molecular weight of 208.22 g/mol. Its IUPAC name is 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine.
Molecular Properties
| Compound Name | 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine |
| PubChem CID | 79542816 |
| Molecular Formula | C8H12N6O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine |
| SMILES | CCc1c(N)nnn1Cc1nnc(C)o1 |
| InChI | InChI=1S/C8H12N6O/c1-3-6-8(9)12-13-14(6)4-7-11-10-5(2)15-7/h3-4,9H2,1-2H3 |
| InChIKey | PCCIPMLCXLULQR-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine?
The IUPAC name of 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine (CID 79542816) is 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine.
What is the SMILES notation for 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine?
The canonical SMILES for 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine is CCc1c(N)nnn1Cc1nnc(C)o1.
What is the InChIKey of 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine?
The InChIKey is PCCIPMLCXLULQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N6O/c1-3-6-8(9)12-13-14(6)4-7-11-10-5(2)15-7/h3-4,9H2,1-2H3.
What are the key properties of 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine?
5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine has a molecular weight of 208.22 g/mol, XLogP of 0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]triazol-4-amine is sourced from PubChem (CID 79542816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).