C11H13N2O3S- — CID 7954379
1-[(2R)-butan-2-yl]benzimidazole-2-sulfonate (PubChem CID 7954379) has the molecular formula C11H13N2O3S- and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]benzimidazole-2-sulfonate.
| Compound Name | 1-[(2R)-butan-2-yl]benzimidazole-2-sulfonate |
|---|---|
| PubChem CID | 7954379 |
| Molecular Formula | C11H13N2O3S- |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 1-[(2R)-butan-2-yl]benzimidazole-2-sulfonate |
| SMILES | CC[C@@H](C)n1c(S(=O)(=O)[O-])nc2ccccc21 |
| InChI | InChI=1S/C11H14N2O3S/c1-3-8(2)13-10-7-5-4-6-9(10)12-11(13)17(14,15)16/h4-8H,3H2,1-2H3,(H,14,15,16)/p-1/t8-/m1/s1 |
| InChIKey | YKFFZGDBXRTQIS-MRVPVSSYSA-M |
| XLogP | 1.91 |
| TPSA | 75.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|