methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate

C10H17NO5S — CID 79546798

IUPACmethyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate
SMILESCOC(=O)CS(=O)(=O)N1CCCC1CC(C)=O
InChIInChI=1S/C10H17NO5S/c1-8(12)6-9-4-3-5-11(9)17(14,15)7-10(13)16-2/h9H,3-7H2,1-2H3
InChIKeyJMYBQWVOMOALEK-UHFFFAOYSA-N
MW263.31 g/mol
LogP-0.07
Rot. Bonds5

About methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate

methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate (PubChem CID 79546798) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate.

Molecular Properties

Compound Namemethyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate
PubChem CID79546798
Molecular FormulaC10H17NO5S
Molecular Weight263.31 g/mol
Exact Mass263.08
IUPAC Namemethyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate
SMILESCOC(=O)CS(=O)(=O)N1CCCC1CC(C)=O
InChIInChI=1S/C10H17NO5S/c1-8(12)6-9-4-3-5-11(9)17(14,15)7-10(13)16-2/h9H,3-7H2,1-2H3
InChIKeyJMYBQWVOMOALEK-UHFFFAOYSA-N
XLogP-0.07
TPSA80.75 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.31
LogP ≤ 5-0.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate?
The IUPAC name of methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate (CID 79546798) is methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate.
What is the SMILES notation for methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate?
The canonical SMILES for methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate is COC(=O)CS(=O)(=O)N1CCCC1CC(C)=O.
What is the InChIKey of methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate?
The InChIKey is JMYBQWVOMOALEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO5S/c1-8(12)6-9-4-3-5-11(9)17(14,15)7-10(13)16-2/h9H,3-7H2,1-2H3.
What are the key properties of methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate?
methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate has a molecular weight of 263.31 g/mol, XLogP of -0.07, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(2-oxopropyl)pyrrolidin-1-yl]sulfonylacetate is sourced from PubChem (CID 79546798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).