About 2-amino-N-(2,2-diethoxyethyl)propanamide
2-amino-N-(2,2-diethoxyethyl)propanamide (PubChem CID 79547449) has the molecular formula C9H20N2O3
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-amino-N-(2,2-diethoxyethyl)propanamide.
Molecular Properties
| Compound Name | 2-amino-N-(2,2-diethoxyethyl)propanamide |
| PubChem CID | 79547449 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-amino-N-(2,2-diethoxyethyl)propanamide |
| SMILES | CCOC(CNC(=O)C(C)N)OCC |
| InChI | InChI=1S/C9H20N2O3/c1-4-13-8(14-5-2)6-11-9(12)7(3)10/h7-8H,4-6,10H2,1-3H3,(H,11,12) |
| InChIKey | SYZRDONOEMSNTK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(2,2-diethoxyethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,2-diethoxyethyl)propanamide?
The IUPAC name of 2-amino-N-(2,2-diethoxyethyl)propanamide (CID 79547449) is 2-amino-N-(2,2-diethoxyethyl)propanamide.
What is the SMILES notation for 2-amino-N-(2,2-diethoxyethyl)propanamide?
The canonical SMILES for 2-amino-N-(2,2-diethoxyethyl)propanamide is CCOC(CNC(=O)C(C)N)OCC.
What is the InChIKey of 2-amino-N-(2,2-diethoxyethyl)propanamide?
The InChIKey is SYZRDONOEMSNTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O3/c1-4-13-8(14-5-2)6-11-9(12)7(3)10/h7-8H,4-6,10H2,1-3H3,(H,11,12).
What are the key properties of 2-amino-N-(2,2-diethoxyethyl)propanamide?
2-amino-N-(2,2-diethoxyethyl)propanamide has a molecular weight of 204.27 g/mol, XLogP of -0.15, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,2-diethoxyethyl)propanamide is sourced from PubChem (CID 79547449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).