C13H26N2O3 — CID 79547641
N-(2,2-diethoxyethyl)-4-methylpiperidine-1-carboxamide (PubChem CID 79547641) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-4-methylpiperidine-1-carboxamide.
| Compound Name | N-(2,2-diethoxyethyl)-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 79547641 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | N-(2,2-diethoxyethyl)-4-methylpiperidine-1-carboxamide |
| SMILES | CCOC(CNC(=O)N1CCC(C)CC1)OCC |
| InChI | InChI=1S/C13H26N2O3/c1-4-17-12(18-5-2)10-14-13(16)15-8-6-11(3)7-9-15/h11-12H,4-10H2,1-3H3,(H,14,16) |
| InChIKey | VKPUNRAHSLNTCG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|