About 3-amino-N-(2,2-diethoxyethyl)butanamide
3-amino-N-(2,2-diethoxyethyl)butanamide (PubChem CID 79547712) has the molecular formula C10H22N2O3
and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-amino-N-(2,2-diethoxyethyl)butanamide.
Molecular Properties
| Compound Name | 3-amino-N-(2,2-diethoxyethyl)butanamide |
| PubChem CID | 79547712 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 3-amino-N-(2,2-diethoxyethyl)butanamide |
| SMILES | CCOC(CNC(=O)CC(C)N)OCC |
| InChI | InChI=1S/C10H22N2O3/c1-4-14-10(15-5-2)7-12-9(13)6-8(3)11/h8,10H,4-7,11H2,1-3H3,(H,12,13) |
| InChIKey | MFSSSHZOAGJCBE-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-(2,2-diethoxyethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(2,2-diethoxyethyl)butanamide?
The IUPAC name of 3-amino-N-(2,2-diethoxyethyl)butanamide (CID 79547712) is 3-amino-N-(2,2-diethoxyethyl)butanamide.
What is the SMILES notation for 3-amino-N-(2,2-diethoxyethyl)butanamide?
The canonical SMILES for 3-amino-N-(2,2-diethoxyethyl)butanamide is CCOC(CNC(=O)CC(C)N)OCC.
What is the InChIKey of 3-amino-N-(2,2-diethoxyethyl)butanamide?
The InChIKey is MFSSSHZOAGJCBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O3/c1-4-14-10(15-5-2)7-12-9(13)6-8(3)11/h8,10H,4-7,11H2,1-3H3,(H,12,13).
What are the key properties of 3-amino-N-(2,2-diethoxyethyl)butanamide?
3-amino-N-(2,2-diethoxyethyl)butanamide has a molecular weight of 218.30 g/mol, XLogP of 0.24, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(2,2-diethoxyethyl)butanamide is sourced from PubChem (CID 79547712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).