About 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine
3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine (PubChem CID 79547861) has the molecular formula C16H24ClNO2
and a molecular weight of 297.83 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine |
| PubChem CID | 79547861 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine |
| SMILES | CCOC(CNC1CC(c2cccc(Cl)c2)C1)OCC |
| InChI | InChI=1S/C16H24ClNO2/c1-3-19-16(20-4-2)11-18-15-9-13(10-15)12-6-5-7-14(17)8-12/h5-8,13,15-16,18H,3-4,9-11H2,1-2H3 |
| InChIKey | HNRFBMWLXZUQOY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine?
The IUPAC name of 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine (CID 79547861) is 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine.
What is the SMILES notation for 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine?
The canonical SMILES for 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine is CCOC(CNC1CC(c2cccc(Cl)c2)C1)OCC.
What is the InChIKey of 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine?
The InChIKey is HNRFBMWLXZUQOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24ClNO2/c1-3-19-16(20-4-2)11-18-15-9-13(10-15)12-6-5-7-14(17)8-12/h5-8,13,15-16,18H,3-4,9-11H2,1-2H3.
What are the key properties of 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine?
3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine has a molecular weight of 297.83 g/mol, XLogP of 3.57, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-N-(2,2-diethoxyethyl)cyclobutan-1-amine is sourced from PubChem (CID 79547861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).