About 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine
5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine (PubChem CID 79547929) has the molecular formula C9H11N5S
and a molecular weight of 221.29 g/mol. Its IUPAC name is 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine.
Molecular Properties
| Compound Name | 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine |
| PubChem CID | 79547929 |
| Molecular Formula | C9H11N5S |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine |
| SMILES | Nc1nnn(Cc2cscn2)c1C1CC1 |
| InChI | InChI=1S/C9H11N5S/c10-9-8(6-1-2-6)14(13-12-9)3-7-4-15-5-11-7/h4-6H,1-3,10H2 |
| InChIKey | WRPJMBKHBVPSQW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine?
The IUPAC name of 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine (CID 79547929) is 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine.
What is the SMILES notation for 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine?
The canonical SMILES for 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine is Nc1nnn(Cc2cscn2)c1C1CC1.
What is the InChIKey of 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine?
The InChIKey is WRPJMBKHBVPSQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5S/c10-9-8(6-1-2-6)14(13-12-9)3-7-4-15-5-11-7/h4-6H,1-3,10H2.
What are the key properties of 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine?
5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine has a molecular weight of 221.29 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-1-(1,3-thiazol-4-ylmethyl)triazol-4-amine is sourced from PubChem (CID 79547929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).