C13H17BrFNO3 — CID 79547974
4-bromo-N-(2,2-diethoxyethyl)-3-fluorobenzamide (PubChem CID 79547974) has the molecular formula C13H17BrFNO3 and a molecular weight of 334.19 g/mol. Its IUPAC name is 4-bromo-N-(2,2-diethoxyethyl)-3-fluorobenzamide.
| Compound Name | 4-bromo-N-(2,2-diethoxyethyl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 79547974 |
| Molecular Formula | C13H17BrFNO3 |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 4-bromo-N-(2,2-diethoxyethyl)-3-fluorobenzamide |
| SMILES | CCOC(CNC(=O)c1ccc(Br)c(F)c1)OCC |
| InChI | InChI=1S/C13H17BrFNO3/c1-3-18-12(19-4-2)8-16-13(17)9-5-6-10(14)11(15)7-9/h5-7,12H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | SXJUBYPDTMXLLQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|