C9H16N4O4 — CID 79548056
4-amino-N-(2,2-diethoxyethyl)-1,2,5-oxadiazole-3-carboxamide (PubChem CID 79548056) has the molecular formula C9H16N4O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-amino-N-(2,2-diethoxyethyl)-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-(2,2-diethoxyethyl)-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 79548056 |
| Molecular Formula | C9H16N4O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-amino-N-(2,2-diethoxyethyl)-1,2,5-oxadiazole-3-carboxamide |
| SMILES | CCOC(CNC(=O)c1nonc1N)OCC |
| InChI | InChI=1S/C9H16N4O4/c1-3-15-6(16-4-2)5-11-9(14)7-8(10)13-17-12-7/h6H,3-5H2,1-2H3,(H2,10,13)(H,11,14) |
| InChIKey | CWTFPMLUCOLPOZ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|