About [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate
[2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 7954816) has the molecular formula C15H16N2O3S
and a molecular weight of 304.37 g/mol. Its IUPAC name is [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 7954816 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(C)c(C(=O)OCC(=O)N(C)c2ccccc2)s1 |
| InChI | InChI=1S/C15H16N2O3S/c1-10-14(21-11(2)16-10)15(19)20-9-13(18)17(3)12-7-5-4-6-8-12/h4-8H,9H2,1-3H3 |
| InChIKey | ZAWUIYHJSBJAOW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The IUPAC name of [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate (CID 7954816) is [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate is Cc1nc(C)c(C(=O)OCC(=O)N(C)c2ccccc2)s1.
What is the InChIKey of [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The InChIKey is ZAWUIYHJSBJAOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O3S/c1-10-14(21-11(2)16-10)15(19)20-9-13(18)17(3)12-7-5-4-6-8-12/h4-8H,9H2,1-3H3.
What are the key properties of [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
[2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate has a molecular weight of 304.37 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-methylanilino)-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 7954816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).